a) iv) Nitrite ion
b) i) Alkyl chlorides can be prepared by passing dry hydrogen chloride gas through a solution of alcohol or by heating a solution of alcohol in concentrated aqueous HCI in presence of anhydrous zinc chloride as a catalyst.
Or, by the action of alcohols with PCl3, PCI5 or SOCI2.
3R-OH + PCl3 → 3R-CI + H3PO3
R-OH + PCl5 → R-CI + POCl3 + HCl
R-OH + SOCl2 → R-CI + SO2 + HCl
Or, chlorination of hydrocarbons in presence of light or heat.
eg. CH3CH2CH2CH3Cl2 \(\underset{or heat}{\stackrel{Cl_2 NV light}{\longrightarrow}}\) CH3CH2CH2CH2Cl+CH3CH2CH(Cl)CH3
Or, by the addition of hydrogen chloride to alkenes.
eg. CH2=CH2+HCl→CH3−CH3